C10H18N4O8S2 — CID 175844349
[(2S,5R)-2-[formyl(propan-2-ylsulfamoyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844349) has the molecular formula C10H18N4O8S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is [(2S,5R)-2-[formyl(propan-2-ylsulfamoyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[formyl(propan-2-ylsulfamoyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844349 |
| Molecular Formula | C10H18N4O8S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [(2S,5R)-2-[formyl(propan-2-ylsulfamoyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(C)NS(=O)(=O)N(C=O)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H18N4O8S2/c1-7(2)11-23(17,18)13(6-15)9-4-3-8-5-12(9)10(16)14(8)22-24(19,20)21/h6-9,11H,3-5H2,1-2H3,(H,19,20,21)/t8-,9+/m1/s1 |
| InChIKey | HTBWYIJKKYZMBW-BDAKNGLRSA-N |
| XLogP | -1.35 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|