C20H27N3O4 — CID 175850660
butyl (2S,4S)-2-(cyanomethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 175850660) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is butyl (2S,4S)-2-(cyanomethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | butyl (2S,4S)-2-(cyanomethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175850660 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | butyl (2S,4S)-2-(cyanomethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC[C@H](NC(=O)OCc2ccccc2)C[C@H]1CC#N |
| InChI | InChI=1S/C20H27N3O4/c1-2-3-13-26-20(25)23-12-10-17(14-18(23)9-11-21)22-19(24)27-15-16-7-5-4-6-8-16/h4-8,17-18H,2-3,9-10,12-15H2,1H3,(H,22,24)/t17-,18+/m0/s1 |
| InChIKey | AEYNNPKGUOYUSS-ZWKOTPCHSA-N |
| XLogP | 3.60 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|