C27H48FNO5S2Si — CID 175858012
tert-butyl-[[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-tert-butylsulfinyl]-1-(4-fluorophenyl)-6-methoxy-6-oxohexan-2-yl]amino]-oxidosulfanium (PubChem CID 175858012) has the molecular formula C27H48FNO5S2Si and a molecular weight of 577.90 g/mol. Its IUPAC name is tert-butyl-[[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-tert-butylsulfinyl]-1-(4-fluorophenyl)-6-methoxy-6-oxohexan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-tert-butylsulfinyl]-1-(4-fluorophenyl)-6-methoxy-6-oxohexan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175858012 |
| Molecular Formula | C27H48FNO5S2Si |
| Molecular Weight | 577.90 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | tert-butyl-[[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-tert-butylsulfinyl]-1-(4-fluorophenyl)-6-methoxy-6-oxohexan-2-yl]amino]-oxidosulfanium |
| SMILES | COC(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)C(N[S+]([O-])C(C)(C)C)C(c1ccc(F)cc1)[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C27H48FNO5S2Si/c1-25(2,3)35(31)24(19-13-15-20(28)16-14-19)23(29-36(32)26(4,5)6)21(17-18-22(30)33-10)34-37(11,12)27(7,8)9/h13-16,21,23-24,29H,17-18H2,1-12H3/t21-,23?,24?,35+,36?/m0/s1 |
| InChIKey | YVBKCCDDISCURF-WKSDPUQVSA-N |
| XLogP | 6.18 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.90 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|