C18H19Cl2NO2 — CID 175860782
3-(dimethylamino)propyl 4-(2,4-dichlorophenyl)benzoate (PubChem CID 175860782) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 4-(2,4-dichlorophenyl)benzoate.
| Compound Name | 3-(dimethylamino)propyl 4-(2,4-dichlorophenyl)benzoate |
|---|---|
| PubChem CID | 175860782 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-(dimethylamino)propyl 4-(2,4-dichlorophenyl)benzoate |
| SMILES | CN(C)CCCOC(=O)c1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO2/c1-21(2)10-3-11-23-18(22)14-6-4-13(5-7-14)16-9-8-15(19)12-17(16)20/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | DFMUKUQMJJZVFU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|