C5H6NO8P — CID 175861254
(1-amino-2,3-dicarboxy-1-oxopropan-2-yl)oxy-oxido-oxophosphanium (PubChem CID 175861254) has the molecular formula C5H6NO8P and a molecular weight of 239.08 g/mol. Its IUPAC name is (1-amino-2,3-dicarboxy-1-oxopropan-2-yl)oxy-oxido-oxophosphanium.
| Compound Name | (1-amino-2,3-dicarboxy-1-oxopropan-2-yl)oxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 175861254 |
| Molecular Formula | C5H6NO8P |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | (1-amino-2,3-dicarboxy-1-oxopropan-2-yl)oxy-oxido-oxophosphanium |
| SMILES | NC(=O)C(CC(=O)O)(O[P+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C5H6NO8P/c6-3(9)5(4(10)11,1-2(7)8)14-15(12)13/h1H2,(H2,6,9)(H,7,8)(H,10,11) |
| InChIKey | WIJVAYICGWJVQT-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|