C32H31FN4O3 — CID 175881283
tert-butyl 5-(7-carbamoyl-5-fluoro-2-methyl-1H-indol-4-yl)-1-methyl-3,4-dihydro-2H-benzo[k][1,7]phenanthroline-2-carboxylate (PubChem CID 175881283) has the molecular formula C32H31FN4O3 and a molecular weight of 538.62 g/mol. Its IUPAC name is tert-butyl 5-(7-carbamoyl-5-fluoro-2-methyl-1H-indol-4-yl)-1-methyl-3,4-dihydro-2H-benzo[k][1,7]phenanthroline-2-carboxylate.
| Compound Name | tert-butyl 5-(7-carbamoyl-5-fluoro-2-methyl-1H-indol-4-yl)-1-methyl-3,4-dihydro-2H-benzo[k][1,7]phenanthroline-2-carboxylate |
|---|---|
| PubChem CID | 175881283 |
| Molecular Formula | C32H31FN4O3 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | tert-butyl 5-(7-carbamoyl-5-fluoro-2-methyl-1H-indol-4-yl)-1-methyl-3,4-dihydro-2H-benzo[k][1,7]phenanthroline-2-carboxylate |
| SMILES | Cc1cc2c(-c3cc4ncc5ccccc5c4c4c3CCC(C(=O)OC(C)(C)C)N4C)c(F)cc(C(N)=O)c2[nH]1 |
| InChI | InChI=1S/C32H31FN4O3/c1-16-12-21-26(23(33)13-22(30(34)38)28(21)36-16)20-14-24-27(18-9-7-6-8-17(18)15-35-24)29-19(20)10-11-25(37(29)5)31(39)40-32(2,3)4/h6-9,12-15,25,36H,10-11H2,1-5H3,(H2,34,38) |
| InChIKey | KXARXWDLKNOGPV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|