C11H23N7O3 — CID 175888302
(2S)-6-amino-2-[[(2S)-2-amino-5-(2-diazohydrazinyl)pentanoyl]amino]hexanoic acid (PubChem CID 175888302) has the molecular formula C11H23N7O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-amino-5-(2-diazohydrazinyl)pentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-amino-5-(2-diazohydrazinyl)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175888302 |
| Molecular Formula | C11H23N7O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-amino-5-(2-diazohydrazinyl)pentanoyl]amino]hexanoic acid |
| SMILES | [N-]=[N+]=NNCCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C11H23N7O3/c12-6-2-1-5-9(11(20)21)16-10(19)8(13)4-3-7-15-18-17-14/h8-9,15H,1-7,12-13H2,(H,16,19)(H,20,21)/t8-,9-/m0/s1 |
| InChIKey | YIVIFUDXLUTUBE-IUCAKERBSA-N |
| XLogP | -0.39 |
| TPSA | 179.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|