C13H19F2NO3S — CID 175914278
2-(5,5-difluorohexan-2-yl)-4-methoxybenzenesulfonamide (PubChem CID 175914278) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-(5,5-difluorohexan-2-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 2-(5,5-difluorohexan-2-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 175914278 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(5,5-difluorohexan-2-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)c(C(C)CCC(C)(F)F)c1 |
| InChI | InChI=1S/C13H19F2NO3S/c1-9(6-7-13(2,14)15)11-8-10(19-3)4-5-12(11)20(16,17)18/h4-5,8-9H,6-7H2,1-3H3,(H2,16,17,18) |
| InChIKey | IJMMTXGFNGRPSS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |