C21H18Cl2N8 — CID 175915412
2,2-bis(4-chloro-6-phenyl-1,3,5-triazin-2-yl)propane-1,3-diamine (PubChem CID 175915412) has the molecular formula C21H18Cl2N8 and a molecular weight of 453.34 g/mol. Its IUPAC name is 2,2-bis(4-chloro-6-phenyl-1,3,5-triazin-2-yl)propane-1,3-diamine.
| Compound Name | 2,2-bis(4-chloro-6-phenyl-1,3,5-triazin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 175915412 |
| Molecular Formula | C21H18Cl2N8 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2,2-bis(4-chloro-6-phenyl-1,3,5-triazin-2-yl)propane-1,3-diamine |
| SMILES | NCC(CN)(c1nc(Cl)nc(-c2ccccc2)n1)c1nc(Cl)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H18Cl2N8/c22-19-28-15(13-7-3-1-4-8-13)26-17(30-19)21(11-24,12-25)18-27-16(29-20(23)31-18)14-9-5-2-6-10-14/h1-10H,11-12,24-25H2 |
| InChIKey | WZSGWGIYDWEXNW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |