C15H13Cl2N5O4 — CID 175942280
2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 175942280) has the molecular formula C15H13Cl2N5O4 and a molecular weight of 398.21 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 175942280 |
| Molecular Formula | C15H13Cl2N5O4 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)n1nc(Cc2c(Cl)cc(-n3ncc(=O)[nH]c3=O)cc2Cl)oc1=O |
| InChI | InChI=1S/C15H13Cl2N5O4/c1-7(2)21-15(25)26-13(20-21)5-9-10(16)3-8(4-11(9)17)22-14(24)19-12(23)6-18-22/h3-4,6-7H,5H2,1-2H3,(H,19,23,24) |
| InChIKey | RIMSKMCIYCKQFH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |