C16H15Cl2N5O5 — CID 175942290
2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-6-[dideuterio(hydroxy)methyl]-1,2,4-triazine-3,5-dione (PubChem CID 175942290) has the molecular formula C16H15Cl2N5O5 and a molecular weight of 430.24 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-6-[dideuterio(hydroxy)methyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-6-[dideuterio(hydroxy)methyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 175942290 |
| Molecular Formula | C16H15Cl2N5O5 |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[3,5-dichloro-4-[(5-oxo-4-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]phenyl]-6-[dideuterio(hydroxy)methyl]-1,2,4-triazine-3,5-dione |
| SMILES | [2H]C([2H])(O)c1nn(-c2cc(Cl)c(Cc3nn(C(C)C)c(=O)o3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H15Cl2N5O5/c1-7(2)22-16(27)28-13(21-22)5-9-10(17)3-8(4-11(9)18)23-15(26)19-14(25)12(6-24)20-23/h3-4,7,24H,5-6H2,1-2H3,(H,19,25,26)/i6D2 |
| InChIKey | IODVBFQJJAXPDW-NCYHJHSESA-N |
| XLogP | 1.04 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |