About azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride
azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride (PubChem CID 175945005) has the molecular formula C21H46ClN3O
and a molecular weight of 392.07 g/mol. Its IUPAC name is azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride |
| PubChem CID | 175945005 |
| Molecular Formula | C21H46ClN3O |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride |
| SMILES | CCCCCCCCCCCCC(CCCN(C)C)=C(C)C(N)=O.Cl.N |
| InChI | InChI=1S/C21H42N2O.ClH.H3N/c1-5-6-7-8-9-10-11-12-13-14-16-20(19(2)21(22)24)17-15-18-23(3)4;;/h5-18H2,1-4H3,(H2,22,24);1H;1H3 |
| InChIKey | DKFVQYLREWPDEX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride?
The IUPAC name of azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride (CID 175945005) is azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride.
What is the SMILES notation for azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride?
The canonical SMILES for azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride is CCCCCCCCCCCCC(CCCN(C)C)=C(C)C(N)=O.Cl.N.
What is the InChIKey of azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride?
The InChIKey is DKFVQYLREWPDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N2O.ClH.H3N/c1-5-6-7-8-9-10-11-12-13-14-16-20(19(2)21(22)24)17-15-18-23(3)4;;/h5-18H2,1-4H3,(H2,22,24);1H;1H3.
What are the key properties of azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride?
azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride has a molecular weight of 392.07 g/mol, XLogP of 6.02, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-[3-(dimethylamino)propyl]-2-methylpentadec-2-enamide;hydrochloride is sourced from PubChem (CID 175945005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).