C27H18N5O3+ — CID 175945846
2-[4-[3-(5-amino-1,3-benzoxazol-2-yl)-1,3-benzoxazol-3-ium-2-yl]phenyl]-1,3-benzoxazol-6-amine (PubChem CID 175945846) has the molecular formula C27H18N5O3+ and a molecular weight of 460.47 g/mol. Its IUPAC name is 2-[4-[3-(5-amino-1,3-benzoxazol-2-yl)-1,3-benzoxazol-3-ium-2-yl]phenyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[4-[3-(5-amino-1,3-benzoxazol-2-yl)-1,3-benzoxazol-3-ium-2-yl]phenyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 175945846 |
| Molecular Formula | C27H18N5O3+ |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[4-[3-(5-amino-1,3-benzoxazol-2-yl)-1,3-benzoxazol-3-ium-2-yl]phenyl]-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2oc(-[n+]3c(-c4ccc(-c5nc6ccc(N)cc6o5)cc4)oc4ccccc43)nc2c1 |
| InChI | InChI=1S/C27H17N5O3/c28-17-10-12-22-20(13-17)31-27(35-22)32-21-3-1-2-4-23(21)34-26(32)16-7-5-15(6-8-16)25-30-19-11-9-18(29)14-24(19)33-25/h1-14,29H,28H2/p+1 |
| InChIKey | DRYBVQCAGSAWJE-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|