About bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine
bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine (PubChem CID 175964812) has the molecular formula C10H8N2O6P2Pt+2
and a molecular weight of 509.21 g/mol. Its IUPAC name is bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine |
| PubChem CID | 175964812 |
| Molecular Formula | C10H8N2O6P2Pt+2 |
| Molecular Weight | 509.21 g/mol |
| Exact Mass | 508.95 |
| IUPAC Name | bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine |
| SMILES | O=[P+]([O-])[O-].O=[P+]([O-])[O-].[Pt+4].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2HO3P.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-4(2)3;/h1-8H;2*(H,1,2,3);/q;;;+4/p-2 |
| InChIKey | MVXRDWDCFMAHHD-UHFFFAOYSA-L |
| XLogP | -1.13 |
| TPSA | 152.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.21 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine?
The IUPAC name of bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine (CID 175964812) is bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine.
What is the SMILES notation for bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine?
The canonical SMILES for bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine is O=[P+]([O-])[O-].O=[P+]([O-])[O-].[Pt+4].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine?
The InChIKey is MVXRDWDCFMAHHD-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8N2.2HO3P.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-4(2)3;/h1-8H;2*(H,1,2,3);/q;;;+4/p-2.
What are the key properties of bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine?
bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine has a molecular weight of 509.21 g/mol, XLogP of -1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dioxido(oxo)phosphanium);platinum(4+);2-pyridin-2-ylpyridine is sourced from PubChem (CID 175964812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).