C19H23ClF3N5O4S — CID 175973969
1-[1-[(6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-4-(oxolan-3-yloxy)-5-(trifluoromethyl)-2H-pyrimidin-2-amine (PubChem CID 175973969) has the molecular formula C19H23ClF3N5O4S and a molecular weight of 509.94 g/mol. Its IUPAC name is 1-[1-[(6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-4-(oxolan-3-yloxy)-5-(trifluoromethyl)-2H-pyrimidin-2-amine.
| Compound Name | 1-[1-[(6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-4-(oxolan-3-yloxy)-5-(trifluoromethyl)-2H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 175973969 |
| Molecular Formula | C19H23ClF3N5O4S |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 1-[1-[(6-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-4-(oxolan-3-yloxy)-5-(trifluoromethyl)-2H-pyrimidin-2-amine |
| SMILES | NC1N=C(OC2CCOC2)C(C(F)(F)F)=CN1C1CCN(S(=O)(=O)c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C19H23ClF3N5O4S/c20-16-2-1-14(9-25-16)33(29,30)27-6-3-12(4-7-27)28-10-15(19(21,22)23)17(26-18(28)24)32-13-5-8-31-11-13/h1-2,9-10,12-13,18H,3-8,11,24H2 |
| InChIKey | FZBHJJVGWPCXKS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|