About ethoxy N'-cyanocarbamimidate
ethoxy N'-cyanocarbamimidate (PubChem CID 175980357) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is ethoxy N'-cyanocarbamimidate.
Molecular Properties
| Compound Name | ethoxy N'-cyanocarbamimidate |
| PubChem CID | 175980357 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | ethoxy N'-cyanocarbamimidate |
| SMILES | CCOO/C(N)=N\C#N |
| InChI | InChI=1S/C4H7N3O2/c1-2-8-9-4(6)7-3-5/h2H2,1H3,(H2,6,7) |
| InChIKey | JIHKOVWKCAVGOA-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethoxy N'-cyanocarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy N'-cyanocarbamimidate?
The IUPAC name of ethoxy N'-cyanocarbamimidate (CID 175980357) is ethoxy N'-cyanocarbamimidate.
What is the SMILES notation for ethoxy N'-cyanocarbamimidate?
The canonical SMILES for ethoxy N'-cyanocarbamimidate is CCOO/C(N)=N\C#N.
What is the InChIKey of ethoxy N'-cyanocarbamimidate?
The InChIKey is JIHKOVWKCAVGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2/c1-2-8-9-4(6)7-3-5/h2H2,1H3,(H2,6,7).
What are the key properties of ethoxy N'-cyanocarbamimidate?
ethoxy N'-cyanocarbamimidate has a molecular weight of 129.12 g/mol, XLogP of -0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy N'-cyanocarbamimidate is sourced from PubChem (CID 175980357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).