C18H18FeNO2- — CID 175996830
(5-tert-butyl-2H-1,3-oxazol-2-id-4-yl)-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 175996830) has the molecular formula C18H18FeNO2- and a molecular weight of 336.19 g/mol. Its IUPAC name is (5-tert-butyl-2H-1,3-oxazol-2-id-4-yl)-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | (5-tert-butyl-2H-1,3-oxazol-2-id-4-yl)-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 175996830 |
| Molecular Formula | C18H18FeNO2- |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (5-tert-butyl-2H-1,3-oxazol-2-id-4-yl)-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(C)(C)c1o[c-]nc1C([O-])=C1C=CC=C1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C13H14NO2.C5H5.Fe/c1-13(2,3)12-10(14-8-16-12)11(15)9-6-4-5-7-9;1-2-4-5-3-1;/h4-7,15H,1-3H3;1-5H;/q2*-1;+2/p-1 |
| InChIKey | LCXBEWQYGPBFIW-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 49.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|