About tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate
tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate (PubChem CID 176514518) has the molecular formula C22H31F2NO3
and a molecular weight of 395.49 g/mol. Its IUPAC name is tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate |
| PubChem CID | 176514518 |
| Molecular Formula | C22H31F2NO3 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate |
| SMILES | C=Cc1ccc(OCC(F)F)c(CN(C(=O)OC(C)(C)C)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H31F2NO3/c1-5-16-11-12-19(27-15-20(23)24)17(13-16)14-25(18-9-7-6-8-10-18)21(26)28-22(2,3)4/h5,11-13,18,20H,1,6-10,14-15H2,2-4H3 |
| InChIKey | KQRDPNDQCXXFEO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate?
The IUPAC name of tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate (CID 176514518) is tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate?
The canonical SMILES for tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate is C=Cc1ccc(OCC(F)F)c(CN(C(=O)OC(C)(C)C)C2CCCCC2)c1.
What is the InChIKey of tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate?
The InChIKey is KQRDPNDQCXXFEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31F2NO3/c1-5-16-11-12-19(27-15-20(23)24)17(13-16)14-25(18-9-7-6-8-10-18)21(26)28-22(2,3)4/h5,11-13,18,20H,1,6-10,14-15H2,2-4H3.
What are the key properties of tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate?
tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate has a molecular weight of 395.49 g/mol, XLogP of 6.04, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-cyclohexyl-N-[[2-(2,2-difluoroethoxy)-5-ethenylphenyl]methyl]carbamate is sourced from PubChem (CID 176514518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).