C29H39NO5 — CID 176514774
methyl 5-[1-(4-acetylphenyl)-5-hydroxy-4-[(E)-3-hydroxyoct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]pyrrol-2-yl]pentanoate (PubChem CID 176514774) has the molecular formula C29H39NO5 and a molecular weight of 481.63 g/mol. Its IUPAC name is methyl 5-[1-(4-acetylphenyl)-5-hydroxy-4-[(E)-3-hydroxyoct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]pyrrol-2-yl]pentanoate.
| Compound Name | methyl 5-[1-(4-acetylphenyl)-5-hydroxy-4-[(E)-3-hydroxyoct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]pyrrol-2-yl]pentanoate |
|---|---|
| PubChem CID | 176514774 |
| Molecular Formula | C29H39NO5 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | methyl 5-[1-(4-acetylphenyl)-5-hydroxy-4-[(E)-3-hydroxyoct-1-enyl]-5,6-dihydro-4H-cyclopenta[b]pyrrol-2-yl]pentanoate |
| SMILES | CCCCCC(O)/C=C/C1c2cc(CCCCC(=O)OC)n(-c3ccc(C(C)=O)cc3)c2CC1O |
| InChI | InChI=1S/C29H39NO5/c1-4-5-6-10-24(32)16-17-25-26-18-23(9-7-8-11-29(34)35-3)30(27(26)19-28(25)33)22-14-12-21(13-15-22)20(2)31/h12-18,24-25,28,32-33H,4-11,19H2,1-3H3/b17-16+ |
| InChIKey | ULWRGBHUEZSAHL-WUKNDPDISA-N |
| XLogP | 5.06 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|