C48H98N8O2 — CID 176517013
1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-[(E)-octadec-9-enyl]amino]butyl-[(E)-octadec-9-enyl]amino]-2-hydroxypropyl]guanidine (PubChem CID 176517013) has the molecular formula C48H98N8O2 and a molecular weight of 819.37 g/mol. Its IUPAC name is 1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-[(E)-octadec-9-enyl]amino]butyl-[(E)-octadec-9-enyl]amino]-2-hydroxypropyl]guanidine.
| Compound Name | 1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-[(E)-octadec-9-enyl]amino]butyl-[(E)-octadec-9-enyl]amino]-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 176517013 |
| Molecular Formula | C48H98N8O2 |
| Molecular Weight | 819.37 g/mol |
| Exact Mass | 818.78 |
| IUPAC Name | 1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-[(E)-octadec-9-enyl]amino]butyl-[(E)-octadec-9-enyl]amino]-2-hydroxypropyl]guanidine |
| SMILES | [H]/N=C(\N)NCC(O)CN(CCCCCCCC/C=C/CCCCCCCC)CCCCN(CCCCCCCC/C=C/CCCCCCCC)CC(O)CN=C(N)N |
| InChI | InChI=1S/C48H98N8O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-55(43-45(57)41-53-47(49)50)39-35-36-40-56(44-46(58)42-54-48(51)52)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,45-46,57-58H,3-16,21-44H2,1-2H3,(H4,49,50,53)(H4,51,52,54)/b19-17+,20-18+ |
| InChIKey | QZCNIGNOBWIQBY-XPWSMXQVSA-N |
| XLogP | 9.92 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.37 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|