C42H86N8O2 — CID 176527536
1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-octadec-9-enylamino]butyl-dodec-9-enylamino]-2-hydroxypropyl]guanidine (PubChem CID 176527536) has the molecular formula C42H86N8O2 and a molecular weight of 735.20 g/mol. Its IUPAC name is 1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-octadec-9-enylamino]butyl-dodec-9-enylamino]-2-hydroxypropyl]guanidine.
| Compound Name | 1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-octadec-9-enylamino]butyl-dodec-9-enylamino]-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 176527536 |
| Molecular Formula | C42H86N8O2 |
| Molecular Weight | 735.20 g/mol |
| Exact Mass | 734.69 |
| IUPAC Name | 1-[3-[4-[[3-(diaminomethylideneamino)-2-hydroxypropyl]-octadec-9-enylamino]butyl-dodec-9-enylamino]-2-hydroxypropyl]guanidine |
| SMILES | [H]/N=C(\N)NCC(O)CN(CCCCCCCCC=CCC)CCCCN(CCCCCCCCC=CCCCCCCCC)CC(O)CN=C(N)N |
| InChI | InChI=1S/C42H86N8O2/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-32-50(38-40(52)36-48-42(45)46)34-30-29-33-49(37-39(51)35-47-41(43)44)31-27-25-23-21-14-12-10-8-6-4-2/h6,8,16-17,39-40,51-52H,3-5,7,9-15,18-38H2,1-2H3,(H4,43,44,47)(H4,45,46,48) |
| InChIKey | FWNMPPMLLNGLQT-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.20 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|