C50H102N8 — CID 176526595
1-[3-[4-[[3-(diaminomethylideneamino)-2-methylpropyl]-[(E)-octadec-9-enyl]amino]butyl-[(Z)-octadec-9-enyl]amino]-2-methylpropyl]guanidine (PubChem CID 176526595) has the molecular formula C50H102N8 and a molecular weight of 815.42 g/mol. Its IUPAC name is 1-[3-[4-[[3-(diaminomethylideneamino)-2-methylpropyl]-[(E)-octadec-9-enyl]amino]butyl-[(Z)-octadec-9-enyl]amino]-2-methylpropyl]guanidine.
| Compound Name | 1-[3-[4-[[3-(diaminomethylideneamino)-2-methylpropyl]-[(E)-octadec-9-enyl]amino]butyl-[(Z)-octadec-9-enyl]amino]-2-methylpropyl]guanidine |
|---|---|
| PubChem CID | 176526595 |
| Molecular Formula | C50H102N8 |
| Molecular Weight | 815.42 g/mol |
| Exact Mass | 814.82 |
| IUPAC Name | 1-[3-[4-[[3-(diaminomethylideneamino)-2-methylpropyl]-[(E)-octadec-9-enyl]amino]butyl-[(Z)-octadec-9-enyl]amino]-2-methylpropyl]guanidine |
| SMILES | [H]/N=C(\N)NCC(C)CN(CCCCCCCC/C=C\CCCCCCCC)CCCCN(CCCCCCCC/C=C/CCCCCCCC)CC(C)CN=C(N)N |
| InChI | InChI=1S/C50H102N8/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-57(45-47(3)43-55-49(51)52)41-37-38-42-58(46-48(4)44-56-50(53)54)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,47-48H,5-18,23-46H2,1-4H3,(H4,51,52,55)(H4,53,54,56)/b21-19-,22-20+ |
| InChIKey | OANMNAFWPFNRAU-OLAQIDGISA-N |
| XLogP | 12.47 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.42 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|