C18H22N5O2S+ — CID 176517455
[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]cyclohexa-2,4-dien-1-ylidene]methylidene-methylsulfanium (PubChem CID 176517455) has the molecular formula C18H22N5O2S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is [5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]cyclohexa-2,4-dien-1-ylidene]methylidene-methylsulfanium.
| Compound Name | [5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]cyclohexa-2,4-dien-1-ylidene]methylidene-methylsulfanium |
|---|---|
| PubChem CID | 176517455 |
| Molecular Formula | C18H22N5O2S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]cyclohexa-2,4-dien-1-ylidene]methylidene-methylsulfanium |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CC3=CC=CC(=C=[S+]C)C3)c2n1 |
| InChI | InChI=1S/C18H21N5O2S/c1-3-4-8-25-17-21-15(19)14-16(22-17)23(18(24)20-14)10-12-6-5-7-13(9-12)11-26-2/h5-7H,3-4,8-10H2,1-2H3,(H2-,19,20,21,22,24)/p+1 |
| InChIKey | HRCQAVUJCGXDGR-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|