C8H10O3 — CID 176518071
2-hydroxybuta-2,3-dienyl 2-methylprop-2-enoate (PubChem CID 176518071) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-hydroxybuta-2,3-dienyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxybuta-2,3-dienyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176518071 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-hydroxybuta-2,3-dienyl 2-methylprop-2-enoate |
| SMILES | C=C=C(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C8H10O3/c1-4-7(9)5-11-8(10)6(2)3/h9H,1-2,5H2,3H3 |
| InChIKey | BLEBVADMMLAREE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|