C8H12N2O5 — CID 176522908
5-amino-2-[(1-carboxy-2-oxoethenyl)amino]pentanoic acid (PubChem CID 176522908) has the molecular formula C8H12N2O5 and a molecular weight of 216.19 g/mol. Its IUPAC name is 5-amino-2-[(1-carboxy-2-oxoethenyl)amino]pentanoic acid.
| Compound Name | 5-amino-2-[(1-carboxy-2-oxoethenyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 176522908 |
| Molecular Formula | C8H12N2O5 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 5-amino-2-[(1-carboxy-2-oxoethenyl)amino]pentanoic acid |
| SMILES | NCCCC(NC(=C=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12N2O5/c9-3-1-2-5(7(12)13)10-6(4-11)8(14)15/h5,10H,1-3,9H2,(H,12,13)(H,14,15) |
| InChIKey | GNZQVCGBHVKJOT-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|