C10H21Cl2N5 — CID 176525969
N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride (PubChem CID 176525969) has the molecular formula C10H21Cl2N5 and a molecular weight of 282.22 g/mol. Its IUPAC name is N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride.
| Compound Name | N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 176525969 |
| Molecular Formula | C10H21Cl2N5 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N/C(N)=N/CCC)N1CC=CCC1 |
| InChI | InChI=1S/C10H19N5.2ClH/c1-2-6-13-9(11)14-10(12)15-7-4-3-5-8-15;;/h3-4H,2,5-8H2,1H3,(H4,11,12,13,14);2*1H |
| InChIKey | FVJREAJYXSHJJB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|