C26H20F7NO3 — CID 176526242
ethyl (E)-4-(4-methoxyphenyl)-2-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate (PubChem CID 176526242) has the molecular formula C26H20F7NO3 and a molecular weight of 527.44 g/mol. Its IUPAC name is ethyl (E)-4-(4-methoxyphenyl)-2-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate.
| Compound Name | ethyl (E)-4-(4-methoxyphenyl)-2-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate |
|---|---|
| PubChem CID | 176526242 |
| Molecular Formula | C26H20F7NO3 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | ethyl (E)-4-(4-methoxyphenyl)-2-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccc(OC)cc1)(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C26H20F7NO3/c1-3-37-24(35)25(16-7-5-4-6-8-16,14-13-15-9-11-17(36-2)12-10-15)34-23-21(29)19(27)18(26(31,32)33)20(28)22(23)30/h4-14,34H,3H2,1-2H3/b14-13+ |
| InChIKey | GGPHUWYPAKQJIE-BUHFOSPRSA-N |
| XLogP | 6.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|