C5H6N2O2 — CID 176532064
penta-2,3-dienediamide (PubChem CID 176532064) has the molecular formula C5H6N2O2 and a molecular weight of 126.11 g/mol. Its IUPAC name is penta-2,3-dienediamide.
| Compound Name | penta-2,3-dienediamide |
|---|---|
| PubChem CID | 176532064 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | penta-2,3-dienediamide |
| SMILES | NC(=O)C=C=CC(N)=O |
| InChI | InChI=1S/C5H6N2O2/c6-4(8)2-1-3-5(7)9/h2-3H,(H2,6,8)(H2,7,9) |
| InChIKey | OGTRETPTYSTMET-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|