About 3-diazoprop-2-enamide;ethanol
3-diazoprop-2-enamide;ethanol (PubChem CID 88686164) has the molecular formula C5H9N3O2
and a molecular weight of 143.15 g/mol. Its IUPAC name is 3-diazoprop-2-enamide;ethanol.
Molecular Properties
| Compound Name | 3-diazoprop-2-enamide;ethanol |
| PubChem CID | 88686164 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 3-diazoprop-2-enamide;ethanol |
| SMILES | CCO.[N-]=[N+]=C=CC(N)=O |
| InChI | InChI=1S/C3H3N3O.C2H6O/c4-3(7)1-2-6-5;1-2-3/h1H,(H2,4,7);3H,2H2,1H3 |
| InChIKey | SBNSLZVUTSNNDG-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-diazoprop-2-enamide;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazoprop-2-enamide;ethanol?
The IUPAC name of 3-diazoprop-2-enamide;ethanol (CID 88686164) is 3-diazoprop-2-enamide;ethanol.
What is the SMILES notation for 3-diazoprop-2-enamide;ethanol?
The canonical SMILES for 3-diazoprop-2-enamide;ethanol is CCO.[N-]=[N+]=C=CC(N)=O.
What is the InChIKey of 3-diazoprop-2-enamide;ethanol?
The InChIKey is SBNSLZVUTSNNDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O.C2H6O/c4-3(7)1-2-6-5;1-2-3/h1H,(H2,4,7);3H,2H2,1H3.
What are the key properties of 3-diazoprop-2-enamide;ethanol?
3-diazoprop-2-enamide;ethanol has a molecular weight of 143.15 g/mol, XLogP of -1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazoprop-2-enamide;ethanol is sourced from PubChem (CID 88686164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).