C23H35ClN2OS — CID 176557337
(1E)-2,6-dimethyl-N-(4-methylphenyl)sulfinylbenzenecarbohydrazonoyl chloride;ethane;pentane (PubChem CID 176557337) has the molecular formula C23H35ClN2OS and a molecular weight of 423.07 g/mol. Its IUPAC name is (1E)-2,6-dimethyl-N-(4-methylphenyl)sulfinylbenzenecarbohydrazonoyl chloride;ethane;pentane.
| Compound Name | (1E)-2,6-dimethyl-N-(4-methylphenyl)sulfinylbenzenecarbohydrazonoyl chloride;ethane;pentane |
|---|---|
| PubChem CID | 176557337 |
| Molecular Formula | C23H35ClN2OS |
| Molecular Weight | 423.07 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (1E)-2,6-dimethyl-N-(4-methylphenyl)sulfinylbenzenecarbohydrazonoyl chloride;ethane;pentane |
| SMILES | CC.CCCCC.Cc1ccc(S(=O)N/N=C(/Cl)c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C16H17ClN2OS.C5H12.C2H6/c1-11-7-9-14(10-8-11)21(20)19-18-16(17)15-12(2)5-4-6-13(15)3;1-3-5-4-2;1-2/h4-10,19H,1-3H3;3-5H2,1-2H3;1-2H3/b18-16+;; |
| InChIKey | DWRFOGNCJYPPKW-DDVLFWKVSA-N |
| XLogP | 7.05 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.07 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|