About (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane
(E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane (PubChem CID 176569325) has the molecular formula C9H11ClF2N2
and a molecular weight of 220.65 g/mol. Its IUPAC name is (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane.
Molecular Properties
| Compound Name | (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane |
| PubChem CID | 176569325 |
| Molecular Formula | C9H11ClF2N2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane |
| SMILES | CC.N/N=C/c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C7H5ClF2N2.C2H6/c8-6-5(9)2-1-4(3-12-11)7(6)10;1-2/h1-3H,11H2;1-2H3/b12-3+; |
| InChIKey | PMPMNAUCQPIEHO-QXKVDVGOSA-N |
| XLogP | 2.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane?
The IUPAC name of (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane (CID 176569325) is (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane.
What is the SMILES notation for (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane?
The canonical SMILES for (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane is CC.N/N=C/c1ccc(F)c(Cl)c1F.
What is the InChIKey of (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane?
The InChIKey is PMPMNAUCQPIEHO-QXKVDVGOSA-N. The full InChI is InChI=1S/C7H5ClF2N2.C2H6/c8-6-5(9)2-1-4(3-12-11)7(6)10;1-2/h1-3H,11H2;1-2H3/b12-3+;.
What are the key properties of (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane?
(E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane has a molecular weight of 220.65 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(3-chloro-2,4-difluorophenyl)methylidenehydrazine;ethane is sourced from PubChem (CID 176569325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).