C19H25N4O — CID 176569796
CID 176569796 (PubChem CID 176569796) has the molecular formula C19H25N4O and a molecular weight of 325.44 g/mol.
| Compound Name | CID 176569796 |
|---|---|
| PubChem CID | 176569796 |
| Molecular Formula | C19H25N4O |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)N[C@H]1C=C(C2=C3C=CN=C3C=C[CH]2)CN(C)C1 |
| InChI | InChI=1S/C19H25N4O/c1-4-23(5-2)19(24)21-15-11-14(12-22(3)13-15)16-7-6-8-18-17(16)9-10-20-18/h6-11,15H,4-5,12-13H2,1-3H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | CVWHZYZLFOHALG-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |