C11H19AlN2O — CID 156727576
CID 156727576 (PubChem CID 156727576) has the molecular formula C11H19AlN2O and a molecular weight of 222.27 g/mol.
| Compound Name | CID 156727576 |
|---|---|
| PubChem CID | 156727576 |
| Molecular Formula | C11H19AlN2O |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)[C@H]1C=C([Al])CN(C)C1 |
| InChI | InChI=1S/C11H19N2O.Al/c1-4-13(5-2)11(14)10-7-6-8-12(3)9-10;/h7,10H,4-5,8-9H2,1-3H3;/t10-;/m0./s1 |
| InChIKey | SRQUVWBAPPWQGZ-PPHPATTJSA-N |
| XLogP | 0.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |