C16H29N3 — CID 176569806
3-(3-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 176569806) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 3-(3-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(3-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 176569806 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 3-(3-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1C=C(C2CNC3NCCCC32)CN(C(C)C)C1 |
| InChI | InChI=1S/C16H29N3/c1-11(2)19-9-12(3)7-13(10-19)15-8-18-16-14(15)5-4-6-17-16/h7,11-12,14-18H,4-6,8-10H2,1-3H3 |
| InChIKey | HNBZITQCJYJKKH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|