C20H25N7O4S2 — CID 176582052
tert-butyl N-[2-[[5-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-imidazol-1-yl-4-pyridinyl]oxy]ethyl]carbamate (PubChem CID 176582052) has the molecular formula C20H25N7O4S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-imidazol-1-yl-4-pyridinyl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-imidazol-1-yl-4-pyridinyl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176582052 |
| Molecular Formula | C20H25N7O4S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | tert-butyl N-[2-[[5-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-imidazol-1-yl-4-pyridinyl]oxy]ethyl]carbamate |
| SMILES | CC(=O)Nc1nnc(SCc2cnc(-n3ccnc3)cc2OCCNC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C20H25N7O4S2/c1-13(28)24-17-25-26-19(33-17)32-11-14-10-23-16(27-7-5-21-12-27)9-15(14)30-8-6-22-18(29)31-20(2,3)4/h5,7,9-10,12H,6,8,11H2,1-4H3,(H,22,29)(H,24,25,28) |
| InChIKey | STFOASNHMOBANN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|