C19H25Cl2N3O3 — CID 175291356
tert-butyl N-[4-[3,5-dichloro-2-(imidazol-1-ylmethyl)phenoxy]butyl]carbamate (PubChem CID 175291356) has the molecular formula C19H25Cl2N3O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is tert-butyl N-[4-[3,5-dichloro-2-(imidazol-1-ylmethyl)phenoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[3,5-dichloro-2-(imidazol-1-ylmethyl)phenoxy]butyl]carbamate |
|---|---|
| PubChem CID | 175291356 |
| Molecular Formula | C19H25Cl2N3O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | tert-butyl N-[4-[3,5-dichloro-2-(imidazol-1-ylmethyl)phenoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1cc(Cl)cc(Cl)c1Cn1ccnc1 |
| InChI | InChI=1S/C19H25Cl2N3O3/c1-19(2,3)27-18(25)23-6-4-5-9-26-17-11-14(20)10-16(21)15(17)12-24-8-7-22-13-24/h7-8,10-11,13H,4-6,9,12H2,1-3H3,(H,23,25) |
| InChIKey | DMNKLZPSHOWBJR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|