C30H23O12S- — CID 176583525
2,4,6-tris(4-methoxycarbonyloxyphenyl)benzenesulfonate (PubChem CID 176583525) has the molecular formula C30H23O12S- and a molecular weight of 607.57 g/mol. Its IUPAC name is 2,4,6-tris(4-methoxycarbonyloxyphenyl)benzenesulfonate.
| Compound Name | 2,4,6-tris(4-methoxycarbonyloxyphenyl)benzenesulfonate |
|---|---|
| PubChem CID | 176583525 |
| Molecular Formula | C30H23O12S- |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.09 |
| IUPAC Name | 2,4,6-tris(4-methoxycarbonyloxyphenyl)benzenesulfonate |
| SMILES | COC(=O)Oc1ccc(-c2cc(-c3ccc(OC(=O)OC)cc3)c(S(=O)(=O)[O-])c(-c3ccc(OC(=O)OC)cc3)c2)cc1 |
| InChI | InChI=1S/C30H24O12S/c1-37-28(31)40-22-10-4-18(5-11-22)21-16-25(19-6-12-23(13-7-19)41-29(32)38-2)27(43(34,35)36)26(17-21)20-8-14-24(15-9-20)42-30(33)39-3/h4-17H,1-3H3,(H,34,35,36)/p-1 |
| InChIKey | LYQOOLWSNPGOBE-UHFFFAOYSA-M |
| XLogP | 6.03 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|