C24H20O4 — CID 141003264
(4-tert-butylphenyl) [4-(7-oxo-2-bicyclo[3.1.1]hepta-1,3,5-trienyl)phenyl] carbonate (PubChem CID 141003264) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4-tert-butylphenyl) [4-(7-oxo-2-bicyclo[3.1.1]hepta-1,3,5-trienyl)phenyl] carbonate.
| Compound Name | (4-tert-butylphenyl) [4-(7-oxo-2-bicyclo[3.1.1]hepta-1,3,5-trienyl)phenyl] carbonate |
|---|---|
| PubChem CID | 141003264 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (4-tert-butylphenyl) [4-(7-oxo-2-bicyclo[3.1.1]hepta-1,3,5-trienyl)phenyl] carbonate |
| SMILES | CC(C)(C)c1ccc(OC(=O)Oc2ccc(-c3ccc4cc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C24H20O4/c1-24(2,3)17-7-11-19(12-8-17)28-23(26)27-18-9-4-15(5-10-18)20-13-6-16-14-21(20)22(16)25/h4-14H,1-3H3 |
| InChIKey | PLNZGHCWUJXTFM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|