C62H48N4O2 — CID 176592226
2-[(2Z)-2-[1-[3,5-bis(4-phenylphenyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione (PubChem CID 176592226) has the molecular formula C62H48N4O2 and a molecular weight of 881.09 g/mol. Its IUPAC name is 2-[(2Z)-2-[1-[3,5-bis(4-phenylphenyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione.
| Compound Name | 2-[(2Z)-2-[1-[3,5-bis(4-phenylphenyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 176592226 |
| Molecular Formula | C62H48N4O2 |
| Molecular Weight | 881.09 g/mol |
| Exact Mass | 880.38 |
| IUPAC Name | 2-[(2Z)-2-[1-[3,5-bis(4-phenylphenyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1/C(=C\C=C2C(=O)c3ccccc3C2=O)N(c2cc(-c3ccc(-c4ccccc4)cc3)cc(-c3ccc(-c4ccccc4)cc3)c2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C62H48N4O2/c1-39(2)50-22-15-23-51(40(3)4)58(50)66-57(35-34-54-59(67)52-20-11-12-21-53(52)60(54)68)65(61-62(66)64-56-25-14-13-24-55(56)63-61)49-37-47(45-30-26-43(27-31-45)41-16-7-5-8-17-41)36-48(38-49)46-32-28-44(29-33-46)42-18-9-6-10-19-42/h5-40H,1-4H3/b57-35- |
| InChIKey | KAKJHGQXSDRKRC-AUKWPBTCSA-N |
| XLogP | 15.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.09 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|