C36H22N4O2 — CID 160691061
2-[2-[1,3-bis(2,3,4,5,6-pentadeuteriophenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 160691061) has the molecular formula C36H22N4O2 and a molecular weight of 552.66 g/mol. Its IUPAC name is 2-[2-[1,3-bis(2,3,4,5,6-pentadeuteriophenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[2-[1,3-bis(2,3,4,5,6-pentadeuteriophenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 160691061 |
| Molecular Formula | C36H22N4O2 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 2-[2-[1,3-bis(2,3,4,5,6-pentadeuteriophenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | [2H]c1c([2H])c([2H])c(N2C(=CC=C3C(=O)c4cc5ccccc5cc4C3=O)N(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3nc4ccccc4nc32)c([2H])c1[2H] |
| InChI | InChI=1S/C36H22N4O2/c41-33-27(34(42)29-22-24-12-8-7-11-23(24)21-28(29)33)19-20-32-39(25-13-3-1-4-14-25)35-36(40(32)26-15-5-2-6-16-26)38-31-18-10-9-17-30(31)37-35/h1-22H/i1D,2D,3D,4D,5D,6D,13D,14D,15D,16D |
| InChIKey | QJHZLASHWKKWEZ-QKKUOBQKSA-N |
| XLogP | 7.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|