C27H15N5O2S2 — CID 159330834
(6Z)-6-[2-(1,3-dithiophen-2-ylimidazo[4,5-b]quinoxalin-2-ylidene)ethylidene]cyclopenta[b]pyridine-5,7-dione (PubChem CID 159330834) has the molecular formula C27H15N5O2S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is (6Z)-6-[2-(1,3-dithiophen-2-ylimidazo[4,5-b]quinoxalin-2-ylidene)ethylidene]cyclopenta[b]pyridine-5,7-dione.
| Compound Name | (6Z)-6-[2-(1,3-dithiophen-2-ylimidazo[4,5-b]quinoxalin-2-ylidene)ethylidene]cyclopenta[b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 159330834 |
| Molecular Formula | C27H15N5O2S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (6Z)-6-[2-(1,3-dithiophen-2-ylimidazo[4,5-b]quinoxalin-2-ylidene)ethylidene]cyclopenta[b]pyridine-5,7-dione |
| SMILES | O=C1/C(=C/C=C2N(c3cccs3)c3nc4ccccc4nc3N2c2cccs2)C(=O)c2ncccc21 |
| InChI | InChI=1S/C27H15N5O2S2/c33-24-16-6-3-13-28-23(16)25(34)17(24)11-12-20-31(21-9-4-14-35-21)26-27(32(20)22-10-5-15-36-22)30-19-8-2-1-7-18(19)29-26/h1-15H/b17-11- |
| InChIKey | TWIPMHKBKHSLJW-BOPFTXTBSA-N |
| XLogP | 6.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|