C47H46Cl4N4O2 — CID 158869773
4,5,6,7-tetrachloro-2-[(2Z)-2-[3-(2,4,6-tritert-butylphenyl)-1-(2,4,6-trimethylphenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione (PubChem CID 158869773) has the molecular formula C47H46Cl4N4O2 and a molecular weight of 840.72 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2Z)-2-[3-(2,4,6-tritert-butylphenyl)-1-(2,4,6-trimethylphenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2Z)-2-[3-(2,4,6-tritert-butylphenyl)-1-(2,4,6-trimethylphenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 158869773 |
| Molecular Formula | C47H46Cl4N4O2 |
| Molecular Weight | 840.72 g/mol |
| Exact Mass | 838.24 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2Z)-2-[3-(2,4,6-tritert-butylphenyl)-1-(2,4,6-trimethylphenyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]indene-1,3-dione |
| SMILES | Cc1cc(C)c(N2/C(=C/C=C3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)N(c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c3nc4ccccc4nc32)c(C)c1 |
| InChI | InChI=1S/C47H46Cl4N4O2/c1-23-19-24(2)39(25(3)20-23)54-32(18-17-27-41(56)33-34(42(27)57)36(49)38(51)37(50)35(33)48)55(44-43(54)52-30-15-13-14-16-31(30)53-44)40-28(46(7,8)9)21-26(45(4,5)6)22-29(40)47(10,11)12/h13-22H,1-12H3/b32-18- |
| InChIKey | HPZZJWHPMXLGCM-CAQPMQTCSA-N |
| XLogP | 14.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.72 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|