C50H98N2O6S — CID 176602826
6-[4-(dimethylamino)butylsulfanylcarbonyl-(6,6-dimethyl-7-octoxycarbonyloxyheptyl)amino]hexyl 3-octylundecanoate (PubChem CID 176602826) has the molecular formula C50H98N2O6S and a molecular weight of 855.41 g/mol. Its IUPAC name is 6-[4-(dimethylamino)butylsulfanylcarbonyl-(6,6-dimethyl-7-octoxycarbonyloxyheptyl)amino]hexyl 3-octylundecanoate.
| Compound Name | 6-[4-(dimethylamino)butylsulfanylcarbonyl-(6,6-dimethyl-7-octoxycarbonyloxyheptyl)amino]hexyl 3-octylundecanoate |
|---|---|
| PubChem CID | 176602826 |
| Molecular Formula | C50H98N2O6S |
| Molecular Weight | 855.41 g/mol |
| Exact Mass | 854.71 |
| IUPAC Name | 6-[4-(dimethylamino)butylsulfanylcarbonyl-(6,6-dimethyl-7-octoxycarbonyloxyheptyl)amino]hexyl 3-octylundecanoate |
| SMILES | CCCCCCCCOC(=O)OCC(C)(C)CCCCCN(CCCCCCOC(=O)CC(CCCCCCCC)CCCCCCCC)C(=O)SCCCCN(C)C |
| InChI | InChI=1S/C50H98N2O6S/c1-8-11-14-17-20-26-35-46(36-27-21-18-15-12-9-2)44-47(53)56-41-32-24-22-29-39-52(48(54)59-43-34-31-38-51(6)7)40-30-25-28-37-50(4,5)45-58-49(55)57-42-33-23-19-16-13-10-3/h46H,8-45H2,1-7H3 |
| InChIKey | SGGZECONHMTXOI-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.41 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|