C52H29F4O5S- — CID 176604029
4-[2,4-bis(6H-phenalen-2-yl)-6-(7H-phenalen-1-yl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 176604029) has the molecular formula C52H29F4O5S- and a molecular weight of 841.86 g/mol. Its IUPAC name is 4-[2,4-bis(6H-phenalen-2-yl)-6-(7H-phenalen-1-yl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2,4-bis(6H-phenalen-2-yl)-6-(7H-phenalen-1-yl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 176604029 |
| Molecular Formula | C52H29F4O5S- |
| Molecular Weight | 841.86 g/mol |
| Exact Mass | 841.17 |
| IUPAC Name | 4-[2,4-bis(6H-phenalen-2-yl)-6-(7H-phenalen-1-yl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1c(-c2cc3c4c(cccc4c2)CC=C3)cc(-c2cc3c4c(cccc4c2)CC=C3)cc1-c1ccc2cccc3c2c1C=CC3 |
| InChI | InChI=1S/C52H30F4O5S/c53-46-48(55)51(62(58,59)60)49(56)47(54)50(46)61-52(57)45-40(37-23-33-16-4-9-28-10-5-17-34(24-37)43(28)33)25-36(35-21-31-14-2-7-27-8-3-15-32(22-35)42(27)31)26-41(45)38-20-19-30-12-1-11-29-13-6-18-39(38)44(29)30/h1-7,9,11-12,14-26H,8,10,13H2,(H,58,59,60)/p-1 |
| InChIKey | FRJLZLDPEBMKJK-UHFFFAOYSA-M |
| XLogP | 12.53 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.86 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|