C11H18F4O2 — CID 176614604
(4S)-2,5-dimethyl-4-(2,2,3,3-tetrafluoropropoxy)hexan-3-one (PubChem CID 176614604) has the molecular formula C11H18F4O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is (4S)-2,5-dimethyl-4-(2,2,3,3-tetrafluoropropoxy)hexan-3-one.
| Compound Name | (4S)-2,5-dimethyl-4-(2,2,3,3-tetrafluoropropoxy)hexan-3-one |
|---|---|
| PubChem CID | 176614604 |
| Molecular Formula | C11H18F4O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (4S)-2,5-dimethyl-4-(2,2,3,3-tetrafluoropropoxy)hexan-3-one |
| SMILES | CC(C)C(=O)[C@@H](OCC(F)(F)C(F)F)C(C)C |
| InChI | InChI=1S/C11H18F4O2/c1-6(2)8(16)9(7(3)4)17-5-11(14,15)10(12)13/h6-7,9-10H,5H2,1-4H3/t9-/m0/s1 |
| InChIKey | VDYCALWNZPMSAC-VIFPVBQESA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|