C13H24N2 — CID 176621460
(2S)-1,4-ditert-butyl-2-isocyanopyrrolidine (PubChem CID 176621460) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (2S)-1,4-ditert-butyl-2-isocyanopyrrolidine.
| Compound Name | (2S)-1,4-ditert-butyl-2-isocyanopyrrolidine |
|---|---|
| PubChem CID | 176621460 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (2S)-1,4-ditert-butyl-2-isocyanopyrrolidine |
| SMILES | [C-]#[N+][C@H]1CC(C(C)(C)C)CN1C(C)(C)C |
| InChI | InChI=1S/C13H24N2/c1-12(2,3)10-8-11(14-7)15(9-10)13(4,5)6/h10-11H,8-9H2,1-6H3/t10?,11-/m1/s1 |
| InChIKey | TXJBMHMOENFHIP-RRKGBCIJSA-N |
| XLogP | 3.40 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|