C28H37N5O7 — CID 176667153
6-amino-2-[(6R,8S)-9-hydroxy-1,5-bis(methoxycarbonyl)-7-methyl-6,8-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonan-3-yl]hexanoic acid (PubChem CID 176667153) has the molecular formula C28H37N5O7 and a molecular weight of 555.63 g/mol. Its IUPAC name is 6-amino-2-[(6R,8S)-9-hydroxy-1,5-bis(methoxycarbonyl)-7-methyl-6,8-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonan-3-yl]hexanoic acid.
| Compound Name | 6-amino-2-[(6R,8S)-9-hydroxy-1,5-bis(methoxycarbonyl)-7-methyl-6,8-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonan-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 176667153 |
| Molecular Formula | C28H37N5O7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 6-amino-2-[(6R,8S)-9-hydroxy-1,5-bis(methoxycarbonyl)-7-methyl-6,8-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonan-3-yl]hexanoic acid |
| SMILES | COC(=O)C12CN(C(CCCCN)C(=O)O)CC(C(=O)OC)(C1O)[C@@H](c1ccccn1)N(C)[C@H]2c1ccccn1 |
| InChI | InChI=1S/C28H37N5O7/c1-32-21(18-10-5-8-14-30-18)27(25(37)39-2)16-33(20(23(34)35)12-4-7-13-29)17-28(24(27)36,26(38)40-3)22(32)19-11-6-9-15-31-19/h5-6,8-11,14-15,20-22,24,36H,4,7,12-13,16-17,29H2,1-3H3,(H,34,35)/t20?,21-,22+,24?,27?,28? |
| InChIKey | MRNXTSSQCXFZRX-ZZSDQWGKSA-N |
| XLogP | 0.78 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|