C21H23N3O6 — CID 24773362
dimethyl (2S,6R)-1-(2-hydroxyethyl)-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate (PubChem CID 24773362) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is dimethyl (2S,6R)-1-(2-hydroxyethyl)-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2S,6R)-1-(2-hydroxyethyl)-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24773362 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | dimethyl (2S,6R)-1-(2-hydroxyethyl)-4-oxo-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@H](c2ccccn2)N(CCO)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C21H23N3O6/c1-29-20(27)15-17(13-7-3-5-9-22-13)24(11-12-25)18(14-8-4-6-10-23-14)16(19(15)26)21(28)30-2/h3-10,15-18,25H,11-12H2,1-2H3/t15?,16?,17-,18+ |
| InChIKey | BHQFGFVKSCNTQQ-OWCVQMPJSA-N |
| XLogP | 0.71 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|