C21H23N3O5 — CID 648948
diethyl 4-oxo-2,6-dipyridin-3-ylpiperidine-3,5-dicarboxylate (PubChem CID 648948) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is diethyl 4-oxo-2,6-dipyridin-3-ylpiperidine-3,5-dicarboxylate.
| Compound Name | diethyl 4-oxo-2,6-dipyridin-3-ylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 648948 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | diethyl 4-oxo-2,6-dipyridin-3-ylpiperidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)C(C(=O)OCC)C(c2cccnc2)NC1c1cccnc1 |
| InChI | InChI=1S/C21H23N3O5/c1-3-28-20(26)15-17(13-7-5-9-22-11-13)24-18(14-8-6-10-23-12-14)16(19(15)25)21(27)29-4-2/h5-12,15-18,24H,3-4H2,1-2H3 |
| InChIKey | USISSUPZZPBSRF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|