C25H24N4O5 — CID 24773365
dimethyl (2S,6R)-4-oxo-2,6-dipyridin-2-yl-1-(pyridin-2-ylmethyl)piperidine-3,5-dicarboxylate (PubChem CID 24773365) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is dimethyl (2S,6R)-4-oxo-2,6-dipyridin-2-yl-1-(pyridin-2-ylmethyl)piperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2S,6R)-4-oxo-2,6-dipyridin-2-yl-1-(pyridin-2-ylmethyl)piperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24773365 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | dimethyl (2S,6R)-4-oxo-2,6-dipyridin-2-yl-1-(pyridin-2-ylmethyl)piperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@H](c2ccccn2)N(Cc2ccccn2)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C25H24N4O5/c1-33-24(31)19-21(17-10-4-7-13-27-17)29(15-16-9-3-6-12-26-16)22(18-11-5-8-14-28-18)20(23(19)30)25(32)34-2/h3-14,19-22H,15H2,1-2H3/t19?,20?,21-,22+ |
| InChIKey | LSXZEGDSRUFERY-JQBYJRRVSA-N |
| XLogP | 2.32 |
| TPSA | 111.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|